C15H20Cl2FN3O2 — CID 142515228
1-[2-(2,4-dichlorophenyl)-2-fluoro-2-nitroethyl]imidazole;ethane (PubChem CID 142515228) has the molecular formula C15H20Cl2FN3O2 and a molecular weight of 364.25 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-fluoro-2-nitroethyl]imidazole;ethane.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-fluoro-2-nitroethyl]imidazole;ethane |
|---|---|
| PubChem CID | 142515228 |
| Molecular Formula | C15H20Cl2FN3O2 |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-fluoro-2-nitroethyl]imidazole;ethane |
| SMILES | CC.CC.O=[N+]([O-])C(F)(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H8Cl2FN3O2.2C2H6/c12-8-1-2-9(10(13)5-8)11(14,17(18)19)6-16-4-3-15-7-16;2*1-2/h1-5,7H,6H2;2*1-2H3 |
| InChIKey | GYUGGVHPJFXGNY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|