C18H16Cl2IN3O4 — CID 70549876
1-(2,4-dichlorophenyl)-3-imidazol-1-yl-2-(4-iodophenyl)propan-2-ol;nitric acid (PubChem CID 70549876) has the molecular formula C18H16Cl2IN3O4 and a molecular weight of 536.15 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-imidazol-1-yl-2-(4-iodophenyl)propan-2-ol;nitric acid.
| Compound Name | 1-(2,4-dichlorophenyl)-3-imidazol-1-yl-2-(4-iodophenyl)propan-2-ol;nitric acid |
|---|---|
| PubChem CID | 70549876 |
| Molecular Formula | C18H16Cl2IN3O4 |
| Molecular Weight | 536.15 g/mol |
| Exact Mass | 534.96 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-imidazol-1-yl-2-(4-iodophenyl)propan-2-ol;nitric acid |
| SMILES | O=[N+]([O-])O.OC(Cc1ccc(Cl)cc1Cl)(Cn1ccnc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C18H15Cl2IN2O.HNO3/c19-15-4-1-13(17(20)9-15)10-18(24,11-23-8-7-22-12-23)14-2-5-16(21)6-3-14;2-1(3)4/h1-9,12,24H,10-11H2;(H,2,3,4) |
| InChIKey | FISUUXXASZGSPN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.15 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|