C18H16BrCl2N3O4 — CID 70550084
2-(2-bromo-4-chlorophenyl)-1-(2-chlorophenyl)-3-imidazol-1-ylpropan-2-ol;nitric acid (PubChem CID 70550084) has the molecular formula C18H16BrCl2N3O4 and a molecular weight of 489.15 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenyl)-1-(2-chlorophenyl)-3-imidazol-1-ylpropan-2-ol;nitric acid.
| Compound Name | 2-(2-bromo-4-chlorophenyl)-1-(2-chlorophenyl)-3-imidazol-1-ylpropan-2-ol;nitric acid |
|---|---|
| PubChem CID | 70550084 |
| Molecular Formula | C18H16BrCl2N3O4 |
| Molecular Weight | 489.15 g/mol |
| Exact Mass | 486.97 |
| IUPAC Name | 2-(2-bromo-4-chlorophenyl)-1-(2-chlorophenyl)-3-imidazol-1-ylpropan-2-ol;nitric acid |
| SMILES | O=[N+]([O-])O.OC(Cc1ccccc1Cl)(Cn1ccnc1)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C18H15BrCl2N2O.HNO3/c19-16-9-14(20)5-6-15(16)18(24,11-23-8-7-22-12-23)10-13-3-1-2-4-17(13)21;2-1(3)4/h1-9,12,24H,10-11H2;(H,2,3,4) |
| InChIKey | JXCMMGOODHCPIO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.15 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|