C18H14Cl2N4O3 — CID 173443390
2-(2-chlorophenyl)-2-(4-chlorophenyl)-3-imidazol-1-ylpropanenitrile;nitric acid (PubChem CID 173443390) has the molecular formula C18H14Cl2N4O3 and a molecular weight of 405.24 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-(4-chlorophenyl)-3-imidazol-1-ylpropanenitrile;nitric acid.
| Compound Name | 2-(2-chlorophenyl)-2-(4-chlorophenyl)-3-imidazol-1-ylpropanenitrile;nitric acid |
|---|---|
| PubChem CID | 173443390 |
| Molecular Formula | C18H14Cl2N4O3 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 2-(2-chlorophenyl)-2-(4-chlorophenyl)-3-imidazol-1-ylpropanenitrile;nitric acid |
| SMILES | N#CC(Cn1ccnc1)(c1ccc(Cl)cc1)c1ccccc1Cl.O=[N+]([O-])O |
| InChI | InChI=1S/C18H13Cl2N3.HNO3/c19-15-7-5-14(6-8-15)18(11-21,12-23-10-9-22-13-23)16-3-1-2-4-17(16)20;2-1(3)4/h1-10,13H,12H2;(H,2,3,4) |
| InChIKey | QYQVZAZCMQPPCM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|