C18H15Cl2N3O3 — CID 54452828
[1-(2,6-dichlorophenyl)-3-imidazol-1-yl-2-phenylpropan-2-yl] nitrate (PubChem CID 54452828) has the molecular formula C18H15Cl2N3O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is [1-(2,6-dichlorophenyl)-3-imidazol-1-yl-2-phenylpropan-2-yl] nitrate.
| Compound Name | [1-(2,6-dichlorophenyl)-3-imidazol-1-yl-2-phenylpropan-2-yl] nitrate |
|---|---|
| PubChem CID | 54452828 |
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | [1-(2,6-dichlorophenyl)-3-imidazol-1-yl-2-phenylpropan-2-yl] nitrate |
| SMILES | O=[N+]([O-])OC(Cc1c(Cl)cccc1Cl)(Cn1ccnc1)c1ccccc1 |
| InChI | InChI=1S/C18H15Cl2N3O3/c19-16-7-4-8-17(20)15(16)11-18(26-23(24)25,12-22-10-9-21-13-22)14-5-2-1-3-6-14/h1-10,13H,11-12H2 |
| InChIKey | WWDBKZSLLZJTER-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|