C19H20ClN3O5 — CID 70550149
1-(4-chlorophenyl)-3-imidazol-1-yl-2-(4-methoxyphenyl)propan-2-ol;nitric acid (PubChem CID 70550149) has the molecular formula C19H20ClN3O5 and a molecular weight of 405.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-imidazol-1-yl-2-(4-methoxyphenyl)propan-2-ol;nitric acid.
| Compound Name | 1-(4-chlorophenyl)-3-imidazol-1-yl-2-(4-methoxyphenyl)propan-2-ol;nitric acid |
|---|---|
| PubChem CID | 70550149 |
| Molecular Formula | C19H20ClN3O5 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-imidazol-1-yl-2-(4-methoxyphenyl)propan-2-ol;nitric acid |
| SMILES | COc1ccc(C(O)(Cc2ccc(Cl)cc2)Cn2ccnc2)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C19H19ClN2O2.HNO3/c1-24-18-8-4-16(5-9-18)19(23,13-22-11-10-21-14-22)12-15-2-6-17(20)7-3-15;2-1(3)4/h2-11,14,23H,12-13H2,1H3;(H,2,3,4) |
| InChIKey | BSHPXDYCDBFPFK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|