C20H20Cl3N3O4S — CID 70638499
1-[2-[(4-chlorophenyl)methylsulfanyl]-3-[(2,4-dichlorophenyl)methoxy]propyl]imidazole;nitric acid (PubChem CID 70638499) has the molecular formula C20H20Cl3N3O4S and a molecular weight of 504.82 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenyl)methylsulfanyl]-3-[(2,4-dichlorophenyl)methoxy]propyl]imidazole;nitric acid.
| Compound Name | 1-[2-[(4-chlorophenyl)methylsulfanyl]-3-[(2,4-dichlorophenyl)methoxy]propyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 70638499 |
| Molecular Formula | C20H20Cl3N3O4S |
| Molecular Weight | 504.82 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | 1-[2-[(4-chlorophenyl)methylsulfanyl]-3-[(2,4-dichlorophenyl)methoxy]propyl]imidazole;nitric acid |
| SMILES | Clc1ccc(CSC(COCc2ccc(Cl)cc2Cl)Cn2ccnc2)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C20H19Cl3N2OS.HNO3/c21-17-4-1-15(2-5-17)13-27-19(10-25-8-7-24-14-25)12-26-11-16-3-6-18(22)9-20(16)23;2-1(3)4/h1-9,14,19H,10-13H2;(H,2,3,4) |
| InChIKey | FPXDVTPLYIJWTJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.82 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|