C14H14Cl2N2O3S — CID 88691821
4-(2,4-dichlorophenyl)-4-hydroxy-5-imidazol-1-yl-3-sulfanylpentanoic acid (PubChem CID 88691821) has the molecular formula C14H14Cl2N2O3S and a molecular weight of 361.25 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-4-hydroxy-5-imidazol-1-yl-3-sulfanylpentanoic acid.
| Compound Name | 4-(2,4-dichlorophenyl)-4-hydroxy-5-imidazol-1-yl-3-sulfanylpentanoic acid |
|---|---|
| PubChem CID | 88691821 |
| Molecular Formula | C14H14Cl2N2O3S |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-4-hydroxy-5-imidazol-1-yl-3-sulfanylpentanoic acid |
| SMILES | O=C(O)CC(S)C(O)(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O3S/c15-9-1-2-10(11(16)5-9)14(21,12(22)6-13(19)20)7-18-4-3-17-8-18/h1-5,8,12,21-22H,6-7H2,(H,19,20) |
| InChIKey | UNQWGDRSTQEISB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|