C23H26ClFN2S — CID 22762814
1-[2-[2-(4-chlorophenyl)ethyl]-2-(4-fluorophenyl)sulfanylhexyl]imidazole (PubChem CID 22762814) has the molecular formula C23H26ClFN2S and a molecular weight of 416.99 g/mol. Its IUPAC name is 1-[2-[2-(4-chlorophenyl)ethyl]-2-(4-fluorophenyl)sulfanylhexyl]imidazole.
| Compound Name | 1-[2-[2-(4-chlorophenyl)ethyl]-2-(4-fluorophenyl)sulfanylhexyl]imidazole |
|---|---|
| PubChem CID | 22762814 |
| Molecular Formula | C23H26ClFN2S |
| Molecular Weight | 416.99 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 1-[2-[2-(4-chlorophenyl)ethyl]-2-(4-fluorophenyl)sulfanylhexyl]imidazole |
| SMILES | CCCCC(CCc1ccc(Cl)cc1)(Cn1ccnc1)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C23H26ClFN2S/c1-2-3-13-23(17-27-16-15-26-18-27,28-22-10-8-21(25)9-11-22)14-12-19-4-6-20(24)7-5-19/h4-11,15-16,18H,2-3,12-14,17H2,1H3 |
| InChIKey | NZPMOLKYUKVAGE-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.99 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |