C20H26ClF3N2OS — CID 21423841
1-[3-[4-chloro-3-(trifluoromethyl)phenoxy]-2-heptylsulfanylpropyl]imidazole (PubChem CID 21423841) has the molecular formula C20H26ClF3N2OS and a molecular weight of 434.96 g/mol. Its IUPAC name is 1-[3-[4-chloro-3-(trifluoromethyl)phenoxy]-2-heptylsulfanylpropyl]imidazole.
| Compound Name | 1-[3-[4-chloro-3-(trifluoromethyl)phenoxy]-2-heptylsulfanylpropyl]imidazole |
|---|---|
| PubChem CID | 21423841 |
| Molecular Formula | C20H26ClF3N2OS |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-[3-[4-chloro-3-(trifluoromethyl)phenoxy]-2-heptylsulfanylpropyl]imidazole |
| SMILES | CCCCCCCSC(COc1ccc(Cl)c(C(F)(F)F)c1)Cn1ccnc1 |
| InChI | InChI=1S/C20H26ClF3N2OS/c1-2-3-4-5-6-11-28-17(13-26-10-9-25-15-26)14-27-16-7-8-19(21)18(12-16)20(22,23)24/h7-10,12,15,17H,2-6,11,13-14H2,1H3 |
| InChIKey | UPXCDUNQZZOQGC-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|