C15H20Cl2N2O — CID 70462522
2-(4-chlorophenyl)-1-imidazol-1-yl-3-methylpentan-2-ol;hydrochloride (PubChem CID 70462522) has the molecular formula C15H20Cl2N2O and a molecular weight of 315.24 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-imidazol-1-yl-3-methylpentan-2-ol;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-1-imidazol-1-yl-3-methylpentan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 70462522 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-(4-chlorophenyl)-1-imidazol-1-yl-3-methylpentan-2-ol;hydrochloride |
| SMILES | CCC(C)C(O)(Cn1ccnc1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C15H19ClN2O.ClH/c1-3-12(2)15(19,10-18-9-8-17-11-18)13-4-6-14(16)7-5-13;/h4-9,11-12,19H,3,10H2,1-2H3;1H |
| InChIKey | PVCVFGVRFHFIGO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |