C16H22ClN3O2 — CID 67650371
2-(4-chlorophenoxy)-3-(ethylamino)-1-imidazol-1-yl-3-methylbutan-2-ol (PubChem CID 67650371) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-3-(ethylamino)-1-imidazol-1-yl-3-methylbutan-2-ol.
| Compound Name | 2-(4-chlorophenoxy)-3-(ethylamino)-1-imidazol-1-yl-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 67650371 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-(4-chlorophenoxy)-3-(ethylamino)-1-imidazol-1-yl-3-methylbutan-2-ol |
| SMILES | CCNC(C)(C)C(O)(Cn1ccnc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClN3O2/c1-4-19-15(2,3)16(21,11-20-10-9-18-12-20)22-14-7-5-13(17)6-8-14/h5-10,12,19,21H,4,11H2,1-3H3 |
| InChIKey | FYCUUMHKVNAFJI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|