C11H10Cl2N2O — CID 70530603
1-chloro-2-(4-chlorophenyl)-1-imidazol-1-ylethanol (PubChem CID 70530603) has the molecular formula C11H10Cl2N2O and a molecular weight of 257.12 g/mol. Its IUPAC name is 1-chloro-2-(4-chlorophenyl)-1-imidazol-1-ylethanol.
| Compound Name | 1-chloro-2-(4-chlorophenyl)-1-imidazol-1-ylethanol |
|---|---|
| PubChem CID | 70530603 |
| Molecular Formula | C11H10Cl2N2O |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 1-chloro-2-(4-chlorophenyl)-1-imidazol-1-ylethanol |
| SMILES | OC(Cl)(Cc1ccc(Cl)cc1)n1ccnc1 |
| InChI | InChI=1S/C11H10Cl2N2O/c12-10-3-1-9(2-4-10)7-11(13,16)15-6-5-14-8-15/h1-6,8,16H,7H2 |
| InChIKey | HWRIRWBFKBDJIG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|