C19H18Cl3N3O4S — CID 70604132
1-[1-chloro-2-(4-chlorophenyl)-1-[(4-chlorophenyl)methylsulfanylmethoxy]ethyl]imidazole;nitric acid (PubChem CID 70604132) has the molecular formula C19H18Cl3N3O4S and a molecular weight of 490.80 g/mol. Its IUPAC name is 1-[1-chloro-2-(4-chlorophenyl)-1-[(4-chlorophenyl)methylsulfanylmethoxy]ethyl]imidazole;nitric acid.
| Compound Name | 1-[1-chloro-2-(4-chlorophenyl)-1-[(4-chlorophenyl)methylsulfanylmethoxy]ethyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 70604132 |
| Molecular Formula | C19H18Cl3N3O4S |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 489.01 |
| IUPAC Name | 1-[1-chloro-2-(4-chlorophenyl)-1-[(4-chlorophenyl)methylsulfanylmethoxy]ethyl]imidazole;nitric acid |
| SMILES | Clc1ccc(CSCOC(Cl)(Cc2ccc(Cl)cc2)n2ccnc2)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C19H17Cl3N2OS.HNO3/c20-17-5-1-15(2-6-17)11-19(22,24-10-9-23-13-24)25-14-26-12-16-3-7-18(21)8-4-16;2-1(3)4/h1-10,13H,11-12,14H2;(H,2,3,4) |
| InChIKey | QGSGRAYXXSPQCD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|