C27H25ClFN3 — CID 24745175
1-[(4-chlorophenyl)-(4-fluorophenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]imidazole (PubChem CID 24745175) has the molecular formula C27H25ClFN3 and a molecular weight of 445.97 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-(4-fluorophenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]imidazole.
| Compound Name | 1-[(4-chlorophenyl)-(4-fluorophenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]imidazole |
|---|---|
| PubChem CID | 24745175 |
| Molecular Formula | C27H25ClFN3 |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-[(4-chlorophenyl)-(4-fluorophenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]imidazole |
| SMILES | Fc1ccc(C(c2ccc(Cl)cc2)(c2ccc(CN3CCCC3)cc2)n2ccnc2)cc1 |
| InChI | InChI=1S/C27H25ClFN3/c28-25-11-7-23(8-12-25)27(32-18-15-30-20-32,24-9-13-26(29)14-10-24)22-5-3-21(4-6-22)19-31-16-1-2-17-31/h3-15,18,20H,1-2,16-17,19H2 |
| InChIKey | XMDSHDUITWWPPB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|