C25H24ClN3S — CID 24806440
1-[(3-chlorophenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]-thiophen-2-ylmethyl]imidazole (PubChem CID 24806440) has the molecular formula C25H24ClN3S and a molecular weight of 434.01 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]-thiophen-2-ylmethyl]imidazole.
| Compound Name | 1-[(3-chlorophenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]-thiophen-2-ylmethyl]imidazole |
|---|---|
| PubChem CID | 24806440 |
| Molecular Formula | C25H24ClN3S |
| Molecular Weight | 434.01 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 1-[(3-chlorophenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]-thiophen-2-ylmethyl]imidazole |
| SMILES | Clc1cccc(C(c2ccc(CN3CCCC3)cc2)(c2cccs2)n2ccnc2)c1 |
| InChI | InChI=1S/C25H24ClN3S/c26-23-6-3-5-22(17-23)25(24-7-4-16-30-24,29-15-12-27-19-29)21-10-8-20(9-11-21)18-28-13-1-2-14-28/h3-12,15-17,19H,1-2,13-14,18H2 |
| InChIKey | YPJMHYIATBWPDM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.01 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |