C28H28ClN3O — CID 69499485
1-[(4-chlorophenyl)-(3-methoxyphenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]imidazole (PubChem CID 69499485) has the molecular formula C28H28ClN3O and a molecular weight of 458.01 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-(3-methoxyphenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]imidazole.
| Compound Name | 1-[(4-chlorophenyl)-(3-methoxyphenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]imidazole |
|---|---|
| PubChem CID | 69499485 |
| Molecular Formula | C28H28ClN3O |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 1-[(4-chlorophenyl)-(3-methoxyphenyl)-[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]imidazole |
| SMILES | COc1cccc(C(c2ccc(Cl)cc2)(c2ccc(CN3CCCC3)cc2)n2ccnc2)c1 |
| InChI | InChI=1S/C28H28ClN3O/c1-33-27-6-4-5-25(19-27)28(32-18-15-30-21-32,24-11-13-26(29)14-12-24)23-9-7-22(8-10-23)20-31-16-2-3-17-31/h4-15,18-19,21H,2-3,16-17,20H2,1H3 |
| InChIKey | NTTUYTBWUCZIGM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|