C23H33ClN2O — CID 54387110
1-[3-(4-tert-butylcyclohexyl)-3-[(4-chlorophenyl)methoxy]propyl]imidazole (PubChem CID 54387110) has the molecular formula C23H33ClN2O and a molecular weight of 388.98 g/mol. Its IUPAC name is 1-[3-(4-tert-butylcyclohexyl)-3-[(4-chlorophenyl)methoxy]propyl]imidazole.
| Compound Name | 1-[3-(4-tert-butylcyclohexyl)-3-[(4-chlorophenyl)methoxy]propyl]imidazole |
|---|---|
| PubChem CID | 54387110 |
| Molecular Formula | C23H33ClN2O |
| Molecular Weight | 388.98 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 1-[3-(4-tert-butylcyclohexyl)-3-[(4-chlorophenyl)methoxy]propyl]imidazole |
| SMILES | CC(C)(C)C1CCC(C(CCn2ccnc2)OCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H33ClN2O/c1-23(2,3)20-8-6-19(7-9-20)22(12-14-26-15-13-25-17-26)27-16-18-4-10-21(24)11-5-18/h4-5,10-11,13,15,17,19-20,22H,6-9,12,14,16H2,1-3H3 |
| InChIKey | VDZXWTVZIRWBER-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.98 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |