C16H19ClN2O2 — CID 54148970
1-[[(2R,6S)-6-[(4-chlorophenyl)methoxy]oxan-2-yl]methyl]imidazole (PubChem CID 54148970) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is 1-[[(2R,6S)-6-[(4-chlorophenyl)methoxy]oxan-2-yl]methyl]imidazole.
| Compound Name | 1-[[(2R,6S)-6-[(4-chlorophenyl)methoxy]oxan-2-yl]methyl]imidazole |
|---|---|
| PubChem CID | 54148970 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-[[(2R,6S)-6-[(4-chlorophenyl)methoxy]oxan-2-yl]methyl]imidazole |
| SMILES | Clc1ccc(CO[C@@H]2CCC[C@H](Cn3ccnc3)O2)cc1 |
| InChI | InChI=1S/C16H19ClN2O2/c17-14-6-4-13(5-7-14)11-20-16-3-1-2-15(21-16)10-19-9-8-18-12-19/h4-9,12,15-16H,1-3,10-11H2/t15-,16+/m1/s1 |
| InChIKey | OGJZPAMKWUGELB-CVEARBPZSA-N |
| XLogP | 3.65 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |