C15H18ClN3O — CID 163211298
(2R,5S)-5-[(4-chlorophenyl)methyl]-2-(imidazol-1-ylmethyl)morpholine (PubChem CID 163211298) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is (2R,5S)-5-[(4-chlorophenyl)methyl]-2-(imidazol-1-ylmethyl)morpholine.
| Compound Name | (2R,5S)-5-[(4-chlorophenyl)methyl]-2-(imidazol-1-ylmethyl)morpholine |
|---|---|
| PubChem CID | 163211298 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2R,5S)-5-[(4-chlorophenyl)methyl]-2-(imidazol-1-ylmethyl)morpholine |
| SMILES | Clc1ccc(C[C@H]2CO[C@@H](Cn3ccnc3)CN2)cc1 |
| InChI | InChI=1S/C15H18ClN3O/c16-13-3-1-12(2-4-13)7-14-10-20-15(8-18-14)9-19-6-5-17-11-19/h1-6,11,14-15,18H,7-10H2/t14-,15+/m0/s1 |
| InChIKey | IWHILNWVTIDMJQ-LSDHHAIUSA-N |
| XLogP | 2.14 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |