C14H14ClNO2 — CID 155577166
1-[5-[(4-chlorophenyl)methyl]morpholin-2-yl]prop-2-yn-1-one (PubChem CID 155577166) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is 1-[5-[(4-chlorophenyl)methyl]morpholin-2-yl]prop-2-yn-1-one.
| Compound Name | 1-[5-[(4-chlorophenyl)methyl]morpholin-2-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 155577166 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 1-[5-[(4-chlorophenyl)methyl]morpholin-2-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)C1CNC(Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C14H14ClNO2/c1-2-13(17)14-8-16-12(9-18-14)7-10-3-5-11(15)6-4-10/h1,3-6,12,14,16H,7-9H2 |
| InChIKey | XEXQFTNMGLPTGS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|