C16H24ClNO2 — CID 155765794
3-[(2R,5S)-5-[(4-chlorophenyl)methyl]morpholin-2-yl]pentan-3-ol (PubChem CID 155765794) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 3-[(2R,5S)-5-[(4-chlorophenyl)methyl]morpholin-2-yl]pentan-3-ol.
| Compound Name | 3-[(2R,5S)-5-[(4-chlorophenyl)methyl]morpholin-2-yl]pentan-3-ol |
|---|---|
| PubChem CID | 155765794 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-[(2R,5S)-5-[(4-chlorophenyl)methyl]morpholin-2-yl]pentan-3-ol |
| SMILES | CCC(O)(CC)[C@H]1CN[C@@H](Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C16H24ClNO2/c1-3-16(19,4-2)15-10-18-14(11-20-15)9-12-5-7-13(17)8-6-12/h5-8,14-15,18-19H,3-4,9-11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | YCKXPGNRYSBVHY-LSDHHAIUSA-N |
| XLogP | 2.79 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |