C18H26Cl2 — CID 63542999
1-[2-(4-tert-butylcyclohexyl)-2-chloroethyl]-4-chlorobenzene (PubChem CID 63542999) has the molecular formula C18H26Cl2 and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-[2-(4-tert-butylcyclohexyl)-2-chloroethyl]-4-chlorobenzene.
| Compound Name | 1-[2-(4-tert-butylcyclohexyl)-2-chloroethyl]-4-chlorobenzene |
|---|---|
| PubChem CID | 63542999 |
| Molecular Formula | C18H26Cl2 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-[2-(4-tert-butylcyclohexyl)-2-chloroethyl]-4-chlorobenzene |
| SMILES | CC(C)(C)C1CCC(C(Cl)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H26Cl2/c1-18(2,3)15-8-6-14(7-9-15)17(20)12-13-4-10-16(19)11-5-13/h4-5,10-11,14-15,17H,6-9,12H2,1-3H3 |
| InChIKey | UIZVJCOGIWSXES-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|