C30H36ClN5O8 — CID 19813108
1-[4-[4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]butane-1,2-dione;nitric acid (PubChem CID 19813108) has the molecular formula C30H36ClN5O8 and a molecular weight of 630.10 g/mol. Its IUPAC name is 1-[4-[4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]butane-1,2-dione;nitric acid.
| Compound Name | 1-[4-[4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]butane-1,2-dione;nitric acid |
|---|---|
| PubChem CID | 19813108 |
| Molecular Formula | C30H36ClN5O8 |
| Molecular Weight | 630.10 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | 1-[4-[4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]butane-1,2-dione;nitric acid |
| SMILES | CCC(=O)C(=O)N1CCN(c2ccc(OCC3COC(CCc4ccc(Cl)cc4)(Cn4ccnc4)O3)cc2)CC1.O=[N+]([O-])O |
| InChI | InChI=1S/C30H35ClN4O5.HNO3/c1-2-28(36)29(37)35-17-15-34(16-18-35)25-7-9-26(10-8-25)38-19-27-20-39-30(40-27,21-33-14-13-32-22-33)12-11-23-3-5-24(31)6-4-23;2-1(3)4/h3-10,13-14,22,27H,2,11-12,15-21H2,1H3;(H,2,3,4) |
| InChIKey | IRFKCNYGNHGMFA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 149.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.10 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|