C19H23ClN2O6 — CID 20547826
1-[[2-[2-(4-chlorophenyl)ethyl]-4-ethyl-1,3-dioxolan-2-yl]methyl]imidazole;oxalic acid (PubChem CID 20547826) has the molecular formula C19H23ClN2O6 and a molecular weight of 410.85 g/mol. Its IUPAC name is 1-[[2-[2-(4-chlorophenyl)ethyl]-4-ethyl-1,3-dioxolan-2-yl]methyl]imidazole;oxalic acid.
| Compound Name | 1-[[2-[2-(4-chlorophenyl)ethyl]-4-ethyl-1,3-dioxolan-2-yl]methyl]imidazole;oxalic acid |
|---|---|
| PubChem CID | 20547826 |
| Molecular Formula | C19H23ClN2O6 |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-[[2-[2-(4-chlorophenyl)ethyl]-4-ethyl-1,3-dioxolan-2-yl]methyl]imidazole;oxalic acid |
| SMILES | CCC1COC(CCc2ccc(Cl)cc2)(Cn2ccnc2)O1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H21ClN2O2.C2H2O4/c1-2-16-11-21-17(22-16,12-20-10-9-19-13-20)8-7-14-3-5-15(18)6-4-14;3-1(4)2(5)6/h3-6,9-10,13,16H,2,7-8,11-12H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | HVEDXCNNLYXTNK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|