C23H26ClN3O3 — CID 19813133
4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-N-methylaniline (PubChem CID 19813133) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-N-methylaniline.
| Compound Name | 4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-N-methylaniline |
|---|---|
| PubChem CID | 19813133 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-N-methylaniline |
| SMILES | CNc1ccc(OCC2COC(CCc3ccc(Cl)cc3)(Cn3ccnc3)O2)cc1 |
| InChI | InChI=1S/C23H26ClN3O3/c1-25-20-6-8-21(9-7-20)28-14-22-15-29-23(30-22,16-27-13-12-26-17-27)11-10-18-2-4-19(24)5-3-18/h2-9,12-13,17,22,25H,10-11,14-16H2,1H3 |
| InChIKey | KSRJBHKQGOTHFI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|