C26H31ClN4O3 — CID 19813191
1-[4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine (PubChem CID 19813191) has the molecular formula C26H31ClN4O3 and a molecular weight of 483.01 g/mol. Its IUPAC name is 1-[4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine.
| Compound Name | 1-[4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine |
|---|---|
| PubChem CID | 19813191 |
| Molecular Formula | C26H31ClN4O3 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 1-[4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine |
| SMILES | Clc1ccc(CCC2(Cn3ccnc3)OCC(COc3ccc(N4CCNCC4)cc3)O2)cc1 |
| InChI | InChI=1S/C26H31ClN4O3/c27-22-3-1-21(2-4-22)9-10-26(19-30-14-11-29-20-30)33-18-25(34-26)17-32-24-7-5-23(6-8-24)31-15-12-28-13-16-31/h1-8,11,14,20,25,28H,9-10,12-13,15-19H2 |
| InChIKey | FAAOSCAQZLIEAO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|