C16H19Cl2N3O5 — CID 67751148
1-[[(2R,4S)-4-(chloromethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid (PubChem CID 67751148) has the molecular formula C16H19Cl2N3O5 and a molecular weight of 404.25 g/mol. Its IUPAC name is 1-[[(2R,4S)-4-(chloromethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid.
| Compound Name | 1-[[(2R,4S)-4-(chloromethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 67751148 |
| Molecular Formula | C16H19Cl2N3O5 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 1-[[(2R,4S)-4-(chloromethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid |
| SMILES | ClC[C@@H]1CO[C@@](CCc2ccc(Cl)cc2)(Cn2ccnc2)O1.O=[N+]([O-])O |
| InChI | InChI=1S/C16H18Cl2N2O2.HNO3/c17-9-15-10-21-16(22-15,11-20-8-7-19-12-20)6-5-13-1-3-14(18)4-2-13;2-1(3)4/h1-4,7-8,12,15H,5-6,9-11H2;(H,2,3,4)/t15-,16-;/m1./s1 |
| InChIKey | DYRDITKSNLUSKS-QNBGGDODSA-N |
| XLogP | 3.17 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|