C22H23Cl2N3O5S — CID 70532425
1-[[(2S,4S)-2-[2-(4-chlorophenyl)ethyl]-4-[(4-chlorophenyl)sulfanylmethyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid (PubChem CID 70532425) has the molecular formula C22H23Cl2N3O5S and a molecular weight of 512.42 g/mol. Its IUPAC name is 1-[[(2S,4S)-2-[2-(4-chlorophenyl)ethyl]-4-[(4-chlorophenyl)sulfanylmethyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid.
| Compound Name | 1-[[(2S,4S)-2-[2-(4-chlorophenyl)ethyl]-4-[(4-chlorophenyl)sulfanylmethyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 70532425 |
| Molecular Formula | C22H23Cl2N3O5S |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 1-[[(2S,4S)-2-[2-(4-chlorophenyl)ethyl]-4-[(4-chlorophenyl)sulfanylmethyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid |
| SMILES | Clc1ccc(CC[C@]2(Cn3ccnc3)OC[C@@H](CSc3ccc(Cl)cc3)O2)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C22H22Cl2N2O2S.HNO3/c23-18-3-1-17(2-4-18)9-10-22(15-26-12-11-25-16-26)27-13-20(28-22)14-29-21-7-5-19(24)6-8-21;2-1(3)4/h1-8,11-12,16,20H,9-10,13-15H2;(H,2,3,4)/t20-,22-;/m0./s1 |
| InChIKey | NBTAZDYLBJCZNW-DTRWSJPISA-N |
| XLogP | 5.38 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|