C22H24ClN3O3S — CID 19813171
4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methylsulfinyl]aniline (PubChem CID 19813171) has the molecular formula C22H24ClN3O3S and a molecular weight of 445.97 g/mol. Its IUPAC name is 4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methylsulfinyl]aniline.
| Compound Name | 4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methylsulfinyl]aniline |
|---|---|
| PubChem CID | 19813171 |
| Molecular Formula | C22H24ClN3O3S |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 4-[[2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methylsulfinyl]aniline |
| SMILES | Nc1ccc(S(=O)CC2COC(CCc3ccc(Cl)cc3)(Cn3ccnc3)O2)cc1 |
| InChI | InChI=1S/C22H24ClN3O3S/c23-18-3-1-17(2-4-18)9-10-22(15-26-12-11-25-16-26)28-13-20(29-22)14-30(27)21-7-5-19(24)6-8-21/h1-8,11-12,16,20H,9-10,13-15,24H2 |
| InChIKey | KVZMOJJKELBGOC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|