C23H27N3O5S — CID 19813073
4-[[2-(imidazol-1-ylmethyl)-2-[2-(4-methoxyphenyl)ethyl]-1,3-dioxolan-4-yl]methylsulfonyl]aniline (PubChem CID 19813073) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is 4-[[2-(imidazol-1-ylmethyl)-2-[2-(4-methoxyphenyl)ethyl]-1,3-dioxolan-4-yl]methylsulfonyl]aniline.
| Compound Name | 4-[[2-(imidazol-1-ylmethyl)-2-[2-(4-methoxyphenyl)ethyl]-1,3-dioxolan-4-yl]methylsulfonyl]aniline |
|---|---|
| PubChem CID | 19813073 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 4-[[2-(imidazol-1-ylmethyl)-2-[2-(4-methoxyphenyl)ethyl]-1,3-dioxolan-4-yl]methylsulfonyl]aniline |
| SMILES | COc1ccc(CCC2(Cn3ccnc3)OCC(CS(=O)(=O)c3ccc(N)cc3)O2)cc1 |
| InChI | InChI=1S/C23H27N3O5S/c1-29-20-6-2-18(3-7-20)10-11-23(16-26-13-12-25-17-26)30-14-21(31-23)15-32(27,28)22-8-4-19(24)5-9-22/h2-9,12-13,17,21H,10-11,14-16,24H2,1H3 |
| InChIKey | ZWJDVCXYHSOXFP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|