C16H20ClN3O2 — CID 67651567
N-[2-(4-chlorophenoxy)-5-imidazol-1-ylpentyl]acetamide (PubChem CID 67651567) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)-5-imidazol-1-ylpentyl]acetamide.
| Compound Name | N-[2-(4-chlorophenoxy)-5-imidazol-1-ylpentyl]acetamide |
|---|---|
| PubChem CID | 67651567 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[2-(4-chlorophenoxy)-5-imidazol-1-ylpentyl]acetamide |
| SMILES | CC(=O)NCC(CCCn1ccnc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-13(21)19-11-16(3-2-9-20-10-8-18-12-20)22-15-6-4-14(17)5-7-15/h4-8,10,12,16H,2-3,9,11H2,1H3,(H,19,21) |
| InChIKey | IBIOAUAPKWTPCR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |