C23H24ClN3O4S — CID 139688595
3-[4-[1-[(4-chlorophenyl)sulfonylamino]-5-imidazol-1-ylpentan-2-yl]phenyl]prop-2-enoic acid (PubChem CID 139688595) has the molecular formula C23H24ClN3O4S and a molecular weight of 473.98 g/mol. Its IUPAC name is 3-[4-[1-[(4-chlorophenyl)sulfonylamino]-5-imidazol-1-ylpentan-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[1-[(4-chlorophenyl)sulfonylamino]-5-imidazol-1-ylpentan-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139688595 |
| Molecular Formula | C23H24ClN3O4S |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 3-[4-[1-[(4-chlorophenyl)sulfonylamino]-5-imidazol-1-ylpentan-2-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(C(CCCn2ccnc2)CNS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H24ClN3O4S/c24-21-8-10-22(11-9-21)32(30,31)26-16-20(2-1-14-27-15-13-25-17-27)19-6-3-18(4-7-19)5-12-23(28)29/h3-13,15,17,20,26H,1-2,14,16H2,(H,28,29) |
| InChIKey | XHOIMRAMHFINBL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|