C17H20Cl2N2O4S — CID 45262145
6-[(4-chlorophenyl)sulfonylamino]-5-pyridin-3-ylhexanoic acid;hydrochloride (PubChem CID 45262145) has the molecular formula C17H20Cl2N2O4S and a molecular weight of 419.33 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)sulfonylamino]-5-pyridin-3-ylhexanoic acid;hydrochloride.
| Compound Name | 6-[(4-chlorophenyl)sulfonylamino]-5-pyridin-3-ylhexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 45262145 |
| Molecular Formula | C17H20Cl2N2O4S |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 6-[(4-chlorophenyl)sulfonylamino]-5-pyridin-3-ylhexanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCC(CNS(=O)(=O)c1ccc(Cl)cc1)c1cccnc1 |
| InChI | InChI=1S/C17H19ClN2O4S.ClH/c18-15-6-8-16(9-7-15)25(23,24)20-12-14(3-1-5-17(21)22)13-4-2-10-19-11-13;/h2,4,6-11,14,20H,1,3,5,12H2,(H,21,22);1H |
| InChIKey | KCUOATAGAYBWMZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |