C19H22ClN3O6S — CID 67706916
5-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]-3-pyridin-3-yloxypropanoyl]amino]pentanoic acid (PubChem CID 67706916) has the molecular formula C19H22ClN3O6S and a molecular weight of 455.92 g/mol. Its IUPAC name is 5-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]-3-pyridin-3-yloxypropanoyl]amino]pentanoic acid.
| Compound Name | 5-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]-3-pyridin-3-yloxypropanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 67706916 |
| Molecular Formula | C19H22ClN3O6S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 5-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]-3-pyridin-3-yloxypropanoyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)[C@H](COc1cccnc1)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClN3O6S/c20-14-6-8-16(9-7-14)30(27,28)23-17(13-29-15-4-3-10-21-12-15)19(26)22-11-2-1-5-18(24)25/h3-4,6-10,12,17,23H,1-2,5,11,13H2,(H,22,26)(H,24,25)/t17-/m0/s1 |
| InChIKey | VVEDZIURNZCNIK-KRWDZBQOSA-N |
| XLogP | 1.83 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|