C18H23ClN4O5S — CID 19032816
6-[[2-[(4-chlorophenyl)sulfonylamino]-3-imidazol-1-ylpropanoyl]amino]hexanoic acid (PubChem CID 19032816) has the molecular formula C18H23ClN4O5S and a molecular weight of 442.93 g/mol. Its IUPAC name is 6-[[2-[(4-chlorophenyl)sulfonylamino]-3-imidazol-1-ylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[(4-chlorophenyl)sulfonylamino]-3-imidazol-1-ylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19032816 |
| Molecular Formula | C18H23ClN4O5S |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 6-[[2-[(4-chlorophenyl)sulfonylamino]-3-imidazol-1-ylpropanoyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)C(Cn1ccnc1)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClN4O5S/c19-14-5-7-15(8-6-14)29(27,28)22-16(12-23-11-10-20-13-23)18(26)21-9-3-1-2-4-17(24)25/h5-8,10-11,13,16,22H,1-4,9,12H2,(H,21,26)(H,24,25) |
| InChIKey | YMZAOUDMMPSCHU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|