C18H24Cl2N4O4S — CID 174365161
2-[(4-chlorophenyl)sulfonylamino]-3-imidazol-1-yl-N-(6-oxohexyl)propanamide;hydrochloride (PubChem CID 174365161) has the molecular formula C18H24Cl2N4O4S and a molecular weight of 463.39 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-3-imidazol-1-yl-N-(6-oxohexyl)propanamide;hydrochloride.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-3-imidazol-1-yl-N-(6-oxohexyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 174365161 |
| Molecular Formula | C18H24Cl2N4O4S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-3-imidazol-1-yl-N-(6-oxohexyl)propanamide;hydrochloride |
| SMILES | Cl.O=CCCCCCNC(=O)C(Cn1ccnc1)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClN4O4S.ClH/c19-15-5-7-16(8-6-15)28(26,27)22-17(13-23-11-10-20-14-23)18(25)21-9-3-1-2-4-12-24;/h5-8,10-12,14,17,22H,1-4,9,13H2,(H,21,25);1H |
| InChIKey | BXSIYAPVWMYYLR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|