C22H25ClN4O4S — CID 30143287
(2R)-2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-(3-imidazol-1-ylpropyl)-3-phenylpropanamide (PubChem CID 30143287) has the molecular formula C22H25ClN4O4S and a molecular weight of 476.99 g/mol. Its IUPAC name is (2R)-2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-(3-imidazol-1-ylpropyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-(3-imidazol-1-ylpropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 30143287 |
| Molecular Formula | C22H25ClN4O4S |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (2R)-2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-(3-imidazol-1-ylpropyl)-3-phenylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](Cc2ccccc2)C(=O)NCCCn2ccnc2)cc1Cl |
| InChI | InChI=1S/C22H25ClN4O4S/c1-31-21-9-8-18(15-19(21)23)32(29,30)26-20(14-17-6-3-2-4-7-17)22(28)25-10-5-12-27-13-11-24-16-27/h2-4,6-9,11,13,15-16,20,26H,5,10,12,14H2,1H3,(H,25,28)/t20-/m1/s1 |
| InChIKey | CVFORPKOEXUBOQ-HXUWFJFHSA-N |
| XLogP | 2.64 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|