C12H14ClN3O3S — CID 37498541
3-chloro-N-(2-imidazol-1-ylethyl)-4-methoxybenzenesulfonamide (PubChem CID 37498541) has the molecular formula C12H14ClN3O3S and a molecular weight of 315.78 g/mol. Its IUPAC name is 3-chloro-N-(2-imidazol-1-ylethyl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-(2-imidazol-1-ylethyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 37498541 |
| Molecular Formula | C12H14ClN3O3S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 3-chloro-N-(2-imidazol-1-ylethyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCn2ccnc2)cc1Cl |
| InChI | InChI=1S/C12H14ClN3O3S/c1-19-12-3-2-10(8-11(12)13)20(17,18)15-5-7-16-6-4-14-9-16/h2-4,6,8-9,15H,5,7H2,1H3 |
| InChIKey | SJLIMLJOZXSSII-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |