C17H22Cl2N4O5S — CID 19032788
5-[[2-[(4-chlorophenyl)sulfonylamino]-3-imidazol-1-ylpropanoyl]amino]pentanoic acid;hydrochloride (PubChem CID 19032788) has the molecular formula C17H22Cl2N4O5S and a molecular weight of 465.36 g/mol. Its IUPAC name is 5-[[2-[(4-chlorophenyl)sulfonylamino]-3-imidazol-1-ylpropanoyl]amino]pentanoic acid;hydrochloride.
| Compound Name | 5-[[2-[(4-chlorophenyl)sulfonylamino]-3-imidazol-1-ylpropanoyl]amino]pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 19032788 |
| Molecular Formula | C17H22Cl2N4O5S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 5-[[2-[(4-chlorophenyl)sulfonylamino]-3-imidazol-1-ylpropanoyl]amino]pentanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCCNC(=O)C(Cn1ccnc1)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN4O5S.ClH/c18-13-4-6-14(7-5-13)28(26,27)21-15(11-22-10-9-19-12-22)17(25)20-8-2-1-3-16(23)24;/h4-7,9-10,12,15,21H,1-3,8,11H2,(H,20,25)(H,23,24);1H |
| InChIKey | UIHPHKATCJKBBU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|