C19H22ClN3O6S — CID 67706825
methyl 4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]-3-pyridin-3-yloxypropanoyl]amino]butanoate (PubChem CID 67706825) has the molecular formula C19H22ClN3O6S and a molecular weight of 455.92 g/mol. Its IUPAC name is methyl 4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]-3-pyridin-3-yloxypropanoyl]amino]butanoate.
| Compound Name | methyl 4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]-3-pyridin-3-yloxypropanoyl]amino]butanoate |
|---|---|
| PubChem CID | 67706825 |
| Molecular Formula | C19H22ClN3O6S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | methyl 4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]-3-pyridin-3-yloxypropanoyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)[C@H](COc1cccnc1)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClN3O6S/c1-28-18(24)5-3-11-22-19(25)17(13-29-15-4-2-10-21-12-15)23-30(26,27)16-8-6-14(20)7-9-16/h2,4,6-10,12,17,23H,3,5,11,13H2,1H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | QNFSMDNTEXDNHF-KRWDZBQOSA-N |
| XLogP | 1.53 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|