C22H29ClN2O5S — CID 10096207
methyl (4S)-8-[(4-chlorophenyl)sulfonylamino]-4-(2-pyridin-3-yloxyethyl)octanoate (PubChem CID 10096207) has the molecular formula C22H29ClN2O5S and a molecular weight of 469.00 g/mol. Its IUPAC name is methyl (4S)-8-[(4-chlorophenyl)sulfonylamino]-4-(2-pyridin-3-yloxyethyl)octanoate.
| Compound Name | methyl (4S)-8-[(4-chlorophenyl)sulfonylamino]-4-(2-pyridin-3-yloxyethyl)octanoate |
|---|---|
| PubChem CID | 10096207 |
| Molecular Formula | C22H29ClN2O5S |
| Molecular Weight | 469.00 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | methyl (4S)-8-[(4-chlorophenyl)sulfonylamino]-4-(2-pyridin-3-yloxyethyl)octanoate |
| SMILES | COC(=O)CC[C@H](CCCCNS(=O)(=O)c1ccc(Cl)cc1)CCOc1cccnc1 |
| InChI | InChI=1S/C22H29ClN2O5S/c1-29-22(26)12-7-18(13-16-30-20-6-4-14-24-17-20)5-2-3-15-25-31(27,28)21-10-8-19(23)9-11-21/h4,6,8-11,14,17-18,25H,2-3,5,7,12-13,15-16H2,1H3/t18-/m0/s1 |
| InChIKey | URRPELLSVPQZAJ-SFHVURJKSA-N |
| XLogP | 4.22 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.00 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|