C24H31ClN2O4S — CID 10322858
methyl 8-[(4-chlorophenyl)sulfonylamino]-4-[(E)-3-(4-methyl-3-pyridinyl)prop-2-enyl]octanoate (PubChem CID 10322858) has the molecular formula C24H31ClN2O4S and a molecular weight of 479.04 g/mol. Its IUPAC name is methyl 8-[(4-chlorophenyl)sulfonylamino]-4-[(E)-3-(4-methyl-3-pyridinyl)prop-2-enyl]octanoate.
| Compound Name | methyl 8-[(4-chlorophenyl)sulfonylamino]-4-[(E)-3-(4-methyl-3-pyridinyl)prop-2-enyl]octanoate |
|---|---|
| PubChem CID | 10322858 |
| Molecular Formula | C24H31ClN2O4S |
| Molecular Weight | 479.04 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | methyl 8-[(4-chlorophenyl)sulfonylamino]-4-[(E)-3-(4-methyl-3-pyridinyl)prop-2-enyl]octanoate |
| SMILES | COC(=O)CCC(C/C=C/c1cnccc1C)CCCCNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H31ClN2O4S/c1-19-15-17-26-18-21(19)8-5-7-20(9-14-24(28)31-2)6-3-4-16-27-32(29,30)23-12-10-22(25)11-13-23/h5,8,10-13,15,17-18,20,27H,3-4,6-7,9,14,16H2,1-2H3/b8-5+ |
| InChIKey | TZTMOGKUEWAWKM-VMPITWQZSA-N |
| XLogP | 5.16 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.04 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|