C13H20N2O4S — CID 87038191
methyl 7-(pyridin-3-ylsulfonylamino)heptanoate (PubChem CID 87038191) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is methyl 7-(pyridin-3-ylsulfonylamino)heptanoate.
| Compound Name | methyl 7-(pyridin-3-ylsulfonylamino)heptanoate |
|---|---|
| PubChem CID | 87038191 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | methyl 7-(pyridin-3-ylsulfonylamino)heptanoate |
| SMILES | COC(=O)CCCCCCNS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C13H20N2O4S/c1-19-13(16)8-4-2-3-5-10-15-20(17,18)12-7-6-9-14-11-12/h6-7,9,11,15H,2-5,8,10H2,1H3 |
| InChIKey | RXPODEFRCRHXTQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|