C13H17N3O4S — CID 106545225
methyl 6-[(2-cyano-3-pyridinyl)sulfonylamino]hexanoate (PubChem CID 106545225) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is methyl 6-[(2-cyano-3-pyridinyl)sulfonylamino]hexanoate.
| Compound Name | methyl 6-[(2-cyano-3-pyridinyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 106545225 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | methyl 6-[(2-cyano-3-pyridinyl)sulfonylamino]hexanoate |
| SMILES | COC(=O)CCCCCNS(=O)(=O)c1cccnc1C#N |
| InChI | InChI=1S/C13H17N3O4S/c1-20-13(17)7-3-2-4-9-16-21(18,19)12-6-5-8-15-11(12)10-14/h5-6,8,16H,2-4,7,9H2,1H3 |
| InChIKey | MSQDZYKSQZRRTJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|