C26H29ClN2O4S — CID 19874753
methyl 8-[(4-chlorophenyl)sulfonylamino]-4-(3-pyridin-3-ylphenyl)octanoate (PubChem CID 19874753) has the molecular formula C26H29ClN2O4S and a molecular weight of 501.05 g/mol. Its IUPAC name is methyl 8-[(4-chlorophenyl)sulfonylamino]-4-(3-pyridin-3-ylphenyl)octanoate.
| Compound Name | methyl 8-[(4-chlorophenyl)sulfonylamino]-4-(3-pyridin-3-ylphenyl)octanoate |
|---|---|
| PubChem CID | 19874753 |
| Molecular Formula | C26H29ClN2O4S |
| Molecular Weight | 501.05 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | methyl 8-[(4-chlorophenyl)sulfonylamino]-4-(3-pyridin-3-ylphenyl)octanoate |
| SMILES | COC(=O)CCC(CCCCNS(=O)(=O)c1ccc(Cl)cc1)c1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C26H29ClN2O4S/c1-33-26(30)15-10-20(21-7-4-8-22(18-21)23-9-5-16-28-19-23)6-2-3-17-29-34(31,32)25-13-11-24(27)12-14-25/h4-5,7-9,11-14,16,18-20,29H,2-3,6,10,15,17H2,1H3 |
| InChIKey | UVPFQPPAOTXOKE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.05 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|