C20H25N3O6S — CID 10478117
methyl 8-[(4-nitrophenyl)sulfonylamino]-7-pyridin-3-yloctanoate (PubChem CID 10478117) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is methyl 8-[(4-nitrophenyl)sulfonylamino]-7-pyridin-3-yloctanoate.
| Compound Name | methyl 8-[(4-nitrophenyl)sulfonylamino]-7-pyridin-3-yloctanoate |
|---|---|
| PubChem CID | 10478117 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | methyl 8-[(4-nitrophenyl)sulfonylamino]-7-pyridin-3-yloctanoate |
| SMILES | COC(=O)CCCCCC(CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)c1cccnc1 |
| InChI | InChI=1S/C20H25N3O6S/c1-29-20(24)8-4-2-3-6-17(16-7-5-13-21-14-16)15-22-30(27,28)19-11-9-18(10-12-19)23(25)26/h5,7,9-14,17,22H,2-4,6,8,15H2,1H3 |
| InChIKey | HXTQIPGRIGMYLN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|