C25H27ClN2O4S — CID 68672777
2-benzyl-7-[(4-chlorophenyl)sulfonylamino]-6-pyridin-3-ylheptanoic acid (PubChem CID 68672777) has the molecular formula C25H27ClN2O4S and a molecular weight of 487.02 g/mol. Its IUPAC name is 2-benzyl-7-[(4-chlorophenyl)sulfonylamino]-6-pyridin-3-ylheptanoic acid.
| Compound Name | 2-benzyl-7-[(4-chlorophenyl)sulfonylamino]-6-pyridin-3-ylheptanoic acid |
|---|---|
| PubChem CID | 68672777 |
| Molecular Formula | C25H27ClN2O4S |
| Molecular Weight | 487.02 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-benzyl-7-[(4-chlorophenyl)sulfonylamino]-6-pyridin-3-ylheptanoic acid |
| SMILES | O=C(O)C(CCCC(CNS(=O)(=O)c1ccc(Cl)cc1)c1cccnc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H27ClN2O4S/c26-23-11-13-24(14-12-23)33(31,32)28-18-22(21-10-5-15-27-17-21)9-4-8-20(25(29)30)16-19-6-2-1-3-7-19/h1-3,5-7,10-15,17,20,22,28H,4,8-9,16,18H2,(H,29,30) |
| InChIKey | BBIZHKZLJMRQSZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.02 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |