C21H27ClN2O5S — CID 57232810
3-[3-[(4-chlorophenyl)sulfonylamino]propoxy]-7-pyridin-3-ylheptanoic acid (PubChem CID 57232810) has the molecular formula C21H27ClN2O5S and a molecular weight of 454.98 g/mol. Its IUPAC name is 3-[3-[(4-chlorophenyl)sulfonylamino]propoxy]-7-pyridin-3-ylheptanoic acid.
| Compound Name | 3-[3-[(4-chlorophenyl)sulfonylamino]propoxy]-7-pyridin-3-ylheptanoic acid |
|---|---|
| PubChem CID | 57232810 |
| Molecular Formula | C21H27ClN2O5S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 3-[3-[(4-chlorophenyl)sulfonylamino]propoxy]-7-pyridin-3-ylheptanoic acid |
| SMILES | O=C(O)CC(CCCCc1cccnc1)OCCCNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClN2O5S/c22-18-8-10-20(11-9-18)30(27,28)24-13-4-14-29-19(15-21(25)26)7-2-1-5-17-6-3-12-23-16-17/h3,6,8-12,16,19,24H,1-2,4-5,7,13-15H2,(H,25,26) |
| InChIKey | YYWJBXIWKWMHQE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|