C21H20ClN3O4S — CID 139709186
3-[5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-(pyridin-3-ylmethyl)pyrrol-2-yl]prop-2-enoic acid (PubChem CID 139709186) has the molecular formula C21H20ClN3O4S and a molecular weight of 445.93 g/mol. Its IUPAC name is 3-[5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-(pyridin-3-ylmethyl)pyrrol-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-(pyridin-3-ylmethyl)pyrrol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139709186 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 3-[5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-(pyridin-3-ylmethyl)pyrrol-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(CCNS(=O)(=O)c2ccc(Cl)cc2)n1Cc1cccnc1 |
| InChI | InChI=1S/C21H20ClN3O4S/c22-17-3-8-20(9-4-17)30(28,29)24-13-11-19-6-5-18(7-10-21(26)27)25(19)15-16-2-1-12-23-14-16/h1-10,12,14,24H,11,13,15H2,(H,26,27) |
| InChIKey | FKUWSABCYSIUAC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|